CAS 1342880-63-0 is the registry number for 2-(5-Bromo-2-fluorophenyl)-5-chloro-1,3,4-thiadiazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(5-bromo-2-fluorophenyl)-5-chloro-1,3,4-thiadiazole (CAS 1342880-63-0) is a chemical compound with the molecular formula C8H3BrClFN2S and a molecular weight of 293.54 g/mol. IUPAC name: 2-(5-bromo-2-fluorophenyl)-5-chloro-1,3,4-thiadiazole. InChIKey: WQRYBAOTGQCDRF-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClFN2S |
|---|---|
| Molecular weight | 293.54 g/mol |
| IUPAC name | 2-(5-bromo-2-fluorophenyl)-5-chloro-1,3,4-thiadiazole |
| InChIKey | WQRYBAOTGQCDRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C2=NN=C(S2)Cl)F |
Computed by PubChem (NCBI)