CAS 1342891-70-6 appears in our catalog under these names: Fenquinotrione, Fenquinotrione 100 µg/mL in Acetonitrile, 2-[[8-Chloro-3,4-dihydro-4-(4-methoxyphenyl)-3-oxo-2-quinoxalinyl]carbonyl]-1,3-cyclohexanedione, 95%, 95%, Fenquinotrione, 97.61%, Fenquinotrione, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1ml, 25mg, 50mg, 5 mg, 1x10mg, 1x1ml.
2-[8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carbonyl]cyclohexane-1,3-dione (CAS 1342891-70-6) is a chemical compound with the molecular formula C22H17ClN2O5 and a molecular weight of 424.8 g/mol. IUPAC name: 2-[8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carbonyl]cyclohexane-1,3-dione. InChIKey: KPSTXQYTZBZXMM-UHFFFAOYSA-N.
| Molecular formula | C22H17ClN2O5 |
|---|---|
| Molecular weight | 424.8 g/mol |
| IUPAC name | 2-[8-chloro-4-(4-methoxyphenyl)-3-oxoquinoxaline-2-carbonyl]cyclohexane-1,3-dione |
| InChIKey | KPSTXQYTZBZXMM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C3=C(C(=CC=C3)Cl)N=C(C2=O)C(=O)C4C(=O)CCCC4=O |
Computed by PubChem (NCBI)