Products 1343088-57-2
CAS 1343088-57-2 appears in our catalog under these names: 4-Amino-3-ethoxy-n,n-dimethylbenzamide, 95%, 4-Amino-3-ethoxy-N,N-dimethylbenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
4-amino-3-ethoxy-N,N-dimethylbenzamide (CAS 1343088-57-2) is a chemical compound with the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. IUPAC name: 4-amino-3-ethoxy-N,N-dimethylbenzamide. InChIKey: NDYTXGWTIUDLMK-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 4-amino-3-ethoxy-N,N-dimethylbenzamide |
| InChIKey | NDYTXGWTIUDLMK-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)N(C)C)N |
Computed by PubChem (NCBI)