Products 1343147-64-7

CAS 1343147-64-7 appears in our catalog under these names: 4-(tert-Butylsulfanyl)benzene-1-sulfonyl chloride, 95%, 4-(tert-Butylsulfanyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

4-tert-butylsulfanylbenzenesulfonyl chloride (CAS 1343147-64-7) is a chemical compound with the molecular formula C10H13ClO2S2 and a molecular weight of 264.8 g/mol. IUPAC name: 4-tert-butylsulfanylbenzenesulfonyl chloride. InChIKey: DXPNIVUKEPLKDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClO2S2
Molecular weight264.8 g/mol
IUPAC name4-tert-butylsulfanylbenzenesulfonyl chloride
InChIKeyDXPNIVUKEPLKDZ-UHFFFAOYSA-N
SMILESCC(C)(C)SC1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)