CAS 1343152-18-0 is the registry number for 1-(3-Bromofuran-2-yl)-2,2,2-trifluoroethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-bromofuran-2-yl)-2,2,2-trifluoroethanone (CAS 1343152-18-0) is a chemical compound with the molecular formula C6H2BrF3O2 and a molecular weight of 242.98 g/mol. IUPAC name: 1-(3-bromofuran-2-yl)-2,2,2-trifluoroethanone. InChIKey: DQJDZMPHDOXCKZ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF3O2 |
|---|---|
| Molecular weight | 242.98 g/mol |
| IUPAC name | 1-(3-bromofuran-2-yl)-2,2,2-trifluoroethanone |
| InChIKey | DQJDZMPHDOXCKZ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1Br)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)