CAS 1343211-22-2 appears in our catalog under these names: 2-Ethyl-8-fluoro-3-methylquinolin-4(1H)-one, 98%, 2-Ethyl-8-fluoro-3-methyl-1,4-dihydroquinolin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 0,5g, 50mg.
2-ethyl-8-fluoro-3-methyl-1H-quinolin-4-one (CAS 1343211-22-2) is a chemical compound with the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. IUPAC name: 2-ethyl-8-fluoro-3-methyl-1H-quinolin-4-one. InChIKey: KVVNGXCKCYZLJE-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 2-ethyl-8-fluoro-3-methyl-1H-quinolin-4-one |
| InChIKey | KVVNGXCKCYZLJE-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=O)C2=C(N1)C(=CC=C2)F)C |
Computed by PubChem (NCBI)