Products 134336-72-4
CAS 134336-72-4 is the registry number for SU-740. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]-5-(3-methylbut-2-enoxy)phenoxy]acetic acid (CAS 134336-72-4) is a chemical compound with the molecular formula C26H30O5 and a molecular weight of 422.5 g/mol. IUPAC name: 2-[2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]-5-(3-methylbut-2-enoxy)phenoxy]acetic acid. InChIKey: ANQKJBMYDIXLBL-MDWZMJQESA-N.
| Molecular formula | C26H30O5 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 2-[2-[(E)-3-(4-tert-butylphenyl)prop-2-enoyl]-5-(3-methylbut-2-enoxy)phenoxy]acetic acid |
| InChIKey | ANQKJBMYDIXLBL-MDWZMJQESA-N |
| SMILES | CC(=CCOC1=CC(=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)C(C)(C)C)OCC(=O)O)C |
Computed by PubChem (NCBI)