CAS 14233-53-5 is the registry number for 2,3,5-Tri-O-benzyl-D-arabinitol. Offered by: TRC. Available pack sizes: 25mg.
(2R,3R,4R)-2,3,5-tris(phenylmethoxy)pentane-1,4-diol (CAS 14233-53-5) is a chemical compound with the molecular formula C26H30O5 and a molecular weight of 422.5 g/mol. IUPAC name: (2R,3R,4R)-2,3,5-tris(phenylmethoxy)pentane-1,4-diol. InChIKey: NJEJAQAZBITKET-TWJOJJKGSA-N.
| Molecular formula | C26H30O5 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | (2R,3R,4R)-2,3,5-tris(phenylmethoxy)pentane-1,4-diol |
| InChIKey | NJEJAQAZBITKET-TWJOJJKGSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@H]([C@H]([C@@H](CO)OCC2=CC=CC=C2)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)