CAS 13435-46-6 appears in our catalog under these names: Barium chloranilate, 95%, Barium 2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-bis(olate), 98%, Barium Chloranilate, Chloranilic acid, barium salt. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
Barium(2+);2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate (CAS 13435-46-6) is a chemical compound with the molecular formula C6BaCl2O4 and a molecular weight of 344.29 g/mol. IUPAC name: barium(2+);2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate. InChIKey: IPBSAQBBXCGJQG-UHFFFAOYSA-L.
| Molecular formula | C6BaCl2O4 |
|---|---|
| Molecular weight | 344.29 g/mol |
| IUPAC name | barium(2+);2,5-dichloro-3,6-dioxocyclohexa-1,4-diene-1,4-diolate |
| InChIKey | IPBSAQBBXCGJQG-UHFFFAOYSA-L |
| SMILES | C1(=C(C(=O)C(=C(C1=O)Cl)[O-])Cl)[O-].[Ba+2] |
Computed by PubChem (NCBI)