CAS 134356-74-4 is the registry number for (S)-2-(4-Fluorophenyl)oxirane, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2S)-2-(4-fluorophenyl)oxirane (CAS 134356-74-4) is a chemical compound with the molecular formula C8H7FO and a molecular weight of 138.14 g/mol. IUPAC name: (2S)-2-(4-fluorophenyl)oxirane. InChIKey: ICVNPQMUUHPPOK-MRVPVSSYSA-N.
| Molecular formula | C8H7FO |
|---|---|
| Molecular weight | 138.14 g/mol |
| IUPAC name | (2S)-2-(4-fluorophenyl)oxirane |
| InChIKey | ICVNPQMUUHPPOK-MRVPVSSYSA-N |
| SMILES | C1[C@@H](O1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)