CAS 1343639-41-7 is the registry number for N-(1-(2,4-Dimethylthiazol-5-yl)ethyl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]acetamide (CAS 1343639-41-7) is a chemical compound with the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. IUPAC name: N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]acetamide. InChIKey: FQIPNFCRQXPXPK-UHFFFAOYSA-N.
| Molecular formula | C9H14N2OS |
|---|---|
| Molecular weight | 198.29 g/mol |
| IUPAC name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]acetamide |
| InChIKey | FQIPNFCRQXPXPK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C)C(C)NC(=O)C |
Computed by PubChem (NCBI)