CAS 1343729-71-4 appears in our catalog under these names: 2-Bromo-N-(3-ethynylphenyl)acetamide, 95%, 2-Bromo-N-(3-ethynylphenyl)acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-bromo-N-(3-ethynylphenyl)acetamide (CAS 1343729-71-4) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 2-bromo-N-(3-ethynylphenyl)acetamide. InChIKey: SDYFXLKHSLLUAK-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 2-bromo-N-(3-ethynylphenyl)acetamide |
| InChIKey | SDYFXLKHSLLUAK-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)NC(=O)CBr |
Computed by PubChem (NCBI)