CAS 1343754-63-1 is the registry number for 2-((4-Iodo-1H-pyrazol-1-yl)methyl)-5-methyl-1,3,4-oxadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4-iodopyrazol-1-yl)methyl]-5-methyl-1,3,4-oxadiazole (CAS 1343754-63-1) is a chemical compound with the molecular formula C7H7IN4O and a molecular weight of 290.06 g/mol. IUPAC name: 2-[(4-iodopyrazol-1-yl)methyl]-5-methyl-1,3,4-oxadiazole. InChIKey: DKOIRXPTVLIXGS-UHFFFAOYSA-N.
| Molecular formula | C7H7IN4O |
|---|---|
| Molecular weight | 290.06 g/mol |
| IUPAC name | 2-[(4-iodopyrazol-1-yl)methyl]-5-methyl-1,3,4-oxadiazole |
| InChIKey | DKOIRXPTVLIXGS-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)CN2C=C(C=N2)I |
Computed by PubChem (NCBI)