Products 1343810-32-1

CAS 1343810-32-1 is the registry number for Methyl 3-(3-bromo-2-oxopyrrolidin-1-yl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-(3-bromo-2-oxopyrrolidin-1-yl)propanoate (CAS 1343810-32-1) is a chemical compound with the molecular formula C8H12BrNO3 and a molecular weight of 250.09 g/mol. IUPAC name: methyl 3-(3-bromo-2-oxopyrrolidin-1-yl)propanoate. InChIKey: DPGOCCHUVOACQF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12BrNO3
Molecular weight250.09 g/mol
IUPAC namemethyl 3-(3-bromo-2-oxopyrrolidin-1-yl)propanoate
InChIKeyDPGOCCHUVOACQF-UHFFFAOYSA-N
SMILESCOC(=O)CCN1CCC(C1=O)Br

Computed by PubChem (NCBI)