CAS 134391-02-9 appears in our catalog under these names: Desmethyl Sulfentrazone, 3-Desmethyl Sulfentrazone, >95% (HPLC), Sulfentrazone-desmethyl, Sulfentrazone-desmethyl 100 µg/mL in Acetonitrile, Sulfentrazone desmethyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 10mg, 1mg, 5mg, 1ml, 1x1ml.
N-[2,4-dichloro-5-[4-(difluoromethyl)-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide (CAS 134391-02-9) is a chemical compound with the molecular formula C10H8Cl2F2N4O3S and a molecular weight of 373.16 g/mol. IUPAC name: N-[2,4-dichloro-5-[4-(difluoromethyl)-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide. InChIKey: IPZJLGDHAGKUSR-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2F2N4O3S |
|---|---|
| Molecular weight | 373.16 g/mol |
| IUPAC name | N-[2,4-dichloro-5-[4-(difluoromethyl)-5-oxo-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
| InChIKey | IPZJLGDHAGKUSR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC(=C(C=C1Cl)Cl)N2C(=O)N(C=N2)C(F)F |
Computed by PubChem (NCBI)