CAS 1343946-35-9 appears in our catalog under these names: 3-(3-Chlorophenyl)-1,1,1-trifluoropropan-2-ol, 95%, 3-(3-Chlorophenyl)-1,1,1-trifluoropropan-2-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-chlorophenyl)-1,1,1-trifluoropropan-2-ol (CAS 1343946-35-9) is a chemical compound with the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,1,1-trifluoropropan-2-ol. InChIKey: SVEIEDFKSFGRES-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3O |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | SVEIEDFKSFGRES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CC(C(F)(F)F)O |
Computed by PubChem (NCBI)