Products 13441-28-6
CAS 13441-28-6 is the registry number for 1-Bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione (CAS 13441-28-6) is a chemical compound with the molecular formula C10H13BrO3 and a molecular weight of 261.11 g/mol. IUPAC name: 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione. InChIKey: RYWWJLPKKKYWSY-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO3 |
|---|---|
| Molecular weight | 261.11 g/mol |
| IUPAC name | 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione |
| InChIKey | RYWWJLPKKKYWSY-UHFFFAOYSA-N |
| SMILES | CC1(C2(CCC1(C(=O)OC2=O)Br)C)C |
Computed by PubChem (NCBI)