CAS 1344158-44-6 is the registry number for (9H-Fluoren-9-yl)methyl 4-bromophenethylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9H-fluoren-9-ylmethyl N-[2-(4-bromophenyl)ethyl]carbamate (CAS 1344158-44-6) is a chemical compound with the molecular formula C23H20BrNO2 and a molecular weight of 422.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[2-(4-bromophenyl)ethyl]carbamate. InChIKey: NWEHUKGQZFBKMF-UHFFFAOYSA-N.
| Molecular formula | C23H20BrNO2 |
|---|---|
| Molecular weight | 422.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[2-(4-bromophenyl)ethyl]carbamate |
| InChIKey | NWEHUKGQZFBKMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)