Products 1344223-97-7

CAS 1344223-97-7 is the registry number for 2-((5-Amino-6-chloropyrimidin-4-yl)amino)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[(5-amino-6-chloropyrimidin-4-yl)amino]acetic acid (CAS 1344223-97-7) is a chemical compound with the molecular formula C6H7ClN4O2 and a molecular weight of 202.60 g/mol. IUPAC name: 2-[(5-amino-6-chloropyrimidin-4-yl)amino]acetic acid. InChIKey: IKLOAJHAKLJEFG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClN4O2
Molecular weight202.60 g/mol
IUPAC name2-[(5-amino-6-chloropyrimidin-4-yl)amino]acetic acid
InChIKeyIKLOAJHAKLJEFG-UHFFFAOYSA-N
SMILESC1=NC(=C(C(=N1)Cl)N)NCC(=O)O

Computed by PubChem (NCBI)