Products 134431-49-5
CAS 134431-49-5 is the registry number for KRN-2391. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[(cyanoamino)-pyridin-3-ylmethylidene]amino]ethyl nitrate;methanesulfonic acid (CAS 134431-49-5) is a chemical compound with the molecular formula C10H13N5O6S and a molecular weight of 331.31 g/mol. IUPAC name: 2-[[(cyanoamino)-pyridin-3-ylmethylidene]amino]ethyl nitrate;methanesulfonic acid. InChIKey: BIBJJSCMCXFMML-UHFFFAOYSA-N.
| Molecular formula | C10H13N5O6S |
|---|---|
| Molecular weight | 331.31 g/mol |
| IUPAC name | 2-[[(cyanoamino)-pyridin-3-ylmethylidene]amino]ethyl nitrate;methanesulfonic acid |
| InChIKey | BIBJJSCMCXFMML-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1=CC(=CN=C1)C(=NCCO[N+](=O)[O-])NC#N |
Computed by PubChem (NCBI)