CAS 1344354-06-8 appears in our catalog under these names: 2-Chloro-4H,5H-naphtho(1,2-d)(1,3)thiazole, 95%, 2-Chloro-4H,5H-naphtho(1,2-d)(1,3)thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-4,5-dihydrobenzo[e][1,3]benzothiazole (CAS 1344354-06-8) is a chemical compound with the molecular formula C11H8ClNS and a molecular weight of 221.71 g/mol. IUPAC name: 2-chloro-4,5-dihydrobenzo[e][1,3]benzothiazole. InChIKey: KQLPCAFBJSDMKO-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNS |
|---|---|
| Molecular weight | 221.71 g/mol |
| IUPAC name | 2-chloro-4,5-dihydrobenzo[e][1,3]benzothiazole |
| InChIKey | KQLPCAFBJSDMKO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C3=CC=CC=C31)N=C(S2)Cl |
Computed by PubChem (NCBI)