CAS 1344506-81-5 is the registry number for (R)-(3-(1-aminopropyl)phenyl)(3-(trifluoromethyl)phenyl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[(1R)-1-aminopropyl]phenyl]-[3-(trifluoromethyl)phenyl]methanone (CAS 1344506-81-5) is a chemical compound with the molecular formula C17H16F3NO and a molecular weight of 307.31 g/mol. IUPAC name: [3-[(1R)-1-aminopropyl]phenyl]-[3-(trifluoromethyl)phenyl]methanone. InChIKey: RYKFETRNRBMIRJ-OAHLLOKOSA-N.
| Molecular formula | C17H16F3NO |
|---|---|
| Molecular weight | 307.31 g/mol |
| IUPAC name | [3-[(1R)-1-aminopropyl]phenyl]-[3-(trifluoromethyl)phenyl]methanone |
| InChIKey | RYKFETRNRBMIRJ-OAHLLOKOSA-N |
| SMILES | CC[C@H](C1=CC(=CC=C1)C(=O)C2=CC(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)