CAS 134460-60-9 appears in our catalog under these names: Rel-(1R,6R)-2-oxabicyclo(4.2.0)octan-7-one, 98%, rac-(1R,6R)-2-Oxabicyclo(4.2.0)octan-7-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1R,6R)-2-oxabicyclo[4.2.0]octan-7-one (CAS 134460-60-9) is a chemical compound with the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. IUPAC name: (1R,6R)-2-oxabicyclo[4.2.0]octan-7-one. InChIKey: CKAFSLVZGWLORL-CAHLUQPWSA-N.
| Molecular formula | C7H10O2 |
|---|---|
| Molecular weight | 126.15 g/mol |
| IUPAC name | (1R,6R)-2-oxabicyclo[4.2.0]octan-7-one |
| InChIKey | CKAFSLVZGWLORL-CAHLUQPWSA-N |
| SMILES | C1C[C@@H]2[C@@H](CC2=O)OC1 |
Computed by PubChem (NCBI)