CAS 134476-67-8 is the registry number for Sodium Gualenate Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 3-formyl-8-methyl-5-propan-2-ylazulene-1-sulfonate (CAS 134476-67-8) is a chemical compound with the molecular formula C15H15NaO4S and a molecular weight of 314.3 g/mol. IUPAC name: sodium 3-formyl-8-methyl-5-propan-2-ylazulene-1-sulfonate. InChIKey: LSNZMKMNUOOXBS-UHFFFAOYSA-M.
| Molecular formula | C15H15NaO4S |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | sodium 3-formyl-8-methyl-5-propan-2-ylazulene-1-sulfonate |
| InChIKey | LSNZMKMNUOOXBS-UHFFFAOYSA-M |
| SMILES | CC1=C2C(=CC(=C2C=C(C=C1)C(C)C)C=O)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)