CAS 134484-37-0 is the registry number for (S)-(2'-Methoxy-[1,1'-binaphthalen]-2-yl)diphenylphosphine oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane (CAS 134484-37-0) is a chemical compound with the molecular formula C33H25OP and a molecular weight of 468.5 g/mol. IUPAC name: [1-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane. InChIKey: KRWTWSSMURUMDE-UHFFFAOYSA-N.
| Molecular formula | C33H25OP |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | [1-(2-methoxynaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane |
| InChIKey | KRWTWSSMURUMDE-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=CC=CC=C2C=C1)C3=C(C=CC4=CC=CC=C43)P(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)