Products 1344929-92-5
CAS 1344929-92-5 is the registry number for (S)-1-(4-Chloro-2-fluorophenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(4-chloro-2-fluorophenyl)ethanol (CAS 1344929-92-5) is a chemical compound with the molecular formula C8H8ClFO and a molecular weight of 174.60 g/mol. IUPAC name: (1S)-1-(4-chloro-2-fluorophenyl)ethanol. InChIKey: SFYMSCDTIQQNLH-YFKPBYRVSA-N.
| Molecular formula | C8H8ClFO |
|---|---|
| Molecular weight | 174.60 g/mol |
| IUPAC name | (1S)-1-(4-chloro-2-fluorophenyl)ethanol |
| InChIKey | SFYMSCDTIQQNLH-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1)Cl)F)O |
Computed by PubChem (NCBI)