Products 1344956-23-5
CAS 1344956-23-5 is the registry number for (S)-1-(2-Fluoro-6-isobutoxyphenyl)ethan-1-amine, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg.
(1S)-1-[2-fluoro-6-(2-methylpropoxy)phenyl]ethanamine (CAS 1344956-23-5) is a chemical compound with the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. IUPAC name: (1S)-1-[2-fluoro-6-(2-methylpropoxy)phenyl]ethanamine. InChIKey: ACTYDLBYOJUKPK-VIFPVBQESA-N.
| Molecular formula | C12H18FNO |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | (1S)-1-[2-fluoro-6-(2-methylpropoxy)phenyl]ethanamine |
| InChIKey | ACTYDLBYOJUKPK-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=C(C=CC=C1F)OCC(C)C)N |
Computed by PubChem (NCBI)