Products 134520-88-0
CAS 134520-88-0 is the registry number for CGP-45688. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(4-cyanophenyl)-(tetrazol-2-yl)methyl]benzonitrile (CAS 134520-88-0) is a chemical compound with the molecular formula C16H10N6 and a molecular weight of 286.29 g/mol. IUPAC name: 4-[(4-cyanophenyl)-(tetrazol-2-yl)methyl]benzonitrile. InChIKey: PQSGESDQXVWRGN-UHFFFAOYSA-N.
| Molecular formula | C16H10N6 |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | 4-[(4-cyanophenyl)-(tetrazol-2-yl)methyl]benzonitrile |
| InChIKey | PQSGESDQXVWRGN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)N3N=CN=N3 |
Computed by PubChem (NCBI)