CAS 134523-01-6 appears in our catalog under these names: Atorvastatin sodium, 95%, (3R,5R)-Atorvastatin Sodium Salt, Atorvastatin Sodium/ 99.88% (existing batch purity), Atorvastatin sodium salt - Bio-X â„¢, Atorvastatin sodium. Offered by: Combi-blocks, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 10mg, 25mg, 50mg, 5mg.
Sodium (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate (CAS 134523-01-6) is a chemical compound with the molecular formula C33H34FN2NaO5 and a molecular weight of 580.6 g/mol. IUPAC name: sodium (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate. InChIKey: VVRPOCPLIUDBSA-CNZCJKERSA-M.
| Molecular formula | C33H34FN2NaO5 |
|---|---|
| Molecular weight | 580.6 g/mol |
| IUPAC name | sodium (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoate |
| InChIKey | VVRPOCPLIUDBSA-CNZCJKERSA-M |
| SMILES | CC(C)C1=C(C(=C(N1CC[C@H](C[C@H](CC(=O)[O-])O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4.[Na+] |
Computed by PubChem (NCBI)