CAS 13453-06-0 appears in our catalog under these names: Ammonium tellurate, 95%, Ammonium tellurate, Ammonium tellurate, 99.5% . Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 10g, 50g.
Diazanium;tellurate (CAS 13453-06-0) is a chemical compound with the molecular formula H8N2O4Te and a molecular weight of 227.7 g/mol. IUPAC name: diazanium;tellurate. InChIKey: DRGYXGZFRXFMHF-UHFFFAOYSA-N.
| Molecular formula | H8N2O4Te |
|---|---|
| Molecular weight | 227.7 g/mol |
| IUPAC name | diazanium;tellurate |
| InChIKey | DRGYXGZFRXFMHF-UHFFFAOYSA-N |
| SMILES | [NH4+].[NH4+].[O-][Te](=O)(=O)[O-] |
Computed by PubChem (NCBI)