CAS 134537-54-5 appears in our catalog under these names: 1,1'-Bis(diphenylphosphino)ferrocene monooxide, 1,1'-Bis(diphenylphosphino)ferrocene monooxide, 95%, 95%, 1,1'-Bis(diphenylphosphino)ferrocene monooxide, 95%. Offered by: Chemat Brand, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
Cyclopentyl(diphenyl)phosphane;[cyclopentyl(phenyl)phosphoryl]benzene;iron (CAS 134537-54-5) is a chemical compound with the molecular formula C34H38FeOP2 and a molecular weight of 580.5 g/mol. IUPAC name: cyclopentyl(diphenyl)phosphane;[cyclopentyl(phenyl)phosphoryl]benzene;iron. InChIKey: LHSYMECZUCSDOC-UHFFFAOYSA-N.
| Molecular formula | C34H38FeOP2 |
|---|---|
| Molecular weight | 580.5 g/mol |
| IUPAC name | cyclopentyl(diphenyl)phosphane;[cyclopentyl(phenyl)phosphoryl]benzene;iron |
| InChIKey | LHSYMECZUCSDOC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1CCC(C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3.[Fe] |
Computed by PubChem (NCBI)