CAS 13454-78-9 appears in our catalog under these names: Cesium chromate(VI), Cesium chromate, 99.9% (metals basis) . Offered by: GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 25g.
Dicesium;dioxido(dioxo)chromium (CAS 13454-78-9) is a chemical compound with the molecular formula CrCs2O4 and a molecular weight of 381.805 g/mol. IUPAC name: dicesium;dioxido(dioxo)chromium. InChIKey: BROHICCPQMHYFY-UHFFFAOYSA-N.
| Molecular formula | CrCs2O4 |
|---|---|
| Molecular weight | 381.805 g/mol |
| IUPAC name | dicesium;dioxido(dioxo)chromium |
| InChIKey | BROHICCPQMHYFY-UHFFFAOYSA-N |
| SMILES | [O-][Cr](=O)(=O)[O-].[Cs+].[Cs+] |
Computed by PubChem (NCBI)