CAS 1345471-26-2 is the registry number for 1-Bromo-3-(propane-2-sulfinyl)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
1-bromo-3-propan-2-ylsulfinylbenzene (CAS 1345471-26-2) is a chemical compound with the molecular formula C9H11BrOS and a molecular weight of 247.15 g/mol. IUPAC name: 1-bromo-3-propan-2-ylsulfinylbenzene. InChIKey: LRQCRBOMTRAHLA-UHFFFAOYSA-N.
| Molecular formula | C9H11BrOS |
|---|---|
| Molecular weight | 247.15 g/mol |
| IUPAC name | 1-bromo-3-propan-2-ylsulfinylbenzene |
| InChIKey | LRQCRBOMTRAHLA-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)