CAS 1345471-93-3 is the registry number for 5-Bromo-6-fluoro-1-isopropyl-1,2,3-benzotriazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
5-bromo-6-fluoro-1-propan-2-ylbenzotriazole (CAS 1345471-93-3) is a chemical compound with the molecular formula C9H9BrFN3 and a molecular weight of 258.09 g/mol. IUPAC name: 5-bromo-6-fluoro-1-propan-2-ylbenzotriazole. InChIKey: XLWBVPJNIOOHIS-UHFFFAOYSA-N.
| Molecular formula | C9H9BrFN3 |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1-propan-2-ylbenzotriazole |
| InChIKey | XLWBVPJNIOOHIS-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=CC(=C(C=C2N=N1)Br)F |
Computed by PubChem (NCBI)