CAS 1345472-18-5 is the registry number for 1-[3-(Benzyloxy)phenyl]-4-methanesulfonylbenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-methylsulfonylphenyl)-3-phenylmethoxybenzene (CAS 1345472-18-5) is a chemical compound with the molecular formula C20H18O3S and a molecular weight of 338.4 g/mol. IUPAC name: 1-(4-methylsulfonylphenyl)-3-phenylmethoxybenzene. InChIKey: VDMBFRIHHRJXOM-UHFFFAOYSA-N.
| Molecular formula | C20H18O3S |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 1-(4-methylsulfonylphenyl)-3-phenylmethoxybenzene |
| InChIKey | VDMBFRIHHRJXOM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)