CAS 134575-12-5 appears in our catalog under these names: Exo-6-(BOC-Aminomethyl)-3-azabicyclo[3.1.0]hexane, 95%, tert-Butyl N-(((1S,5R)-3-azabicyclo(3.1.0)hexan-6-yl)methyl)carbamate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,25g, 0,1g, 0,5g, 2g.
Tert-butyl N-[[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]carbamate (CAS 134575-12-5) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-[[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]carbamate. InChIKey: JXWGBEYMMHSBFU-JVHMLUBASA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-[[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]methyl]carbamate |
| InChIKey | JXWGBEYMMHSBFU-JVHMLUBASA-N |
| SMILES | CC(C)(C)OC(=O)NCC1[C@H]2[C@@H]1CNC2 |
Computed by PubChem (NCBI)