CAS 1345808-25-4 appears in our catalog under these names: Arginase inhibitor 1, 98+%, Arginase inhibitor 1, Arginase inhibitor 1, (R)-2-Amino-6-borono-2-(2-(piperidin-1-yl)ethyl)hexanoic acid, 98%, 98%, Arginase inhibitor 1, 98.0%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 1mg, 5mg, 10mg, 2mg, 10mM (in 1ml dmso), 50mg.
(2R)-2-amino-6-borono-2-(2-piperidin-1-ylethyl)hexanoic acid (CAS 1345808-25-4) is a chemical compound with the molecular formula C13H27BN2O4 and a molecular weight of 286.18 g/mol. IUPAC name: (2R)-2-amino-6-borono-2-(2-piperidin-1-ylethyl)hexanoic acid. InChIKey: CHPILBYRQPOXMV-CYBMUJFWSA-N.
| Molecular formula | C13H27BN2O4 |
|---|---|
| Molecular weight | 286.18 g/mol |
| IUPAC name | (2R)-2-amino-6-borono-2-(2-piperidin-1-ylethyl)hexanoic acid |
| InChIKey | CHPILBYRQPOXMV-CYBMUJFWSA-N |
| SMILES | B(CCCC[C@@](CCN1CCCCC1)(C(=O)O)N)(O)O |
Computed by PubChem (NCBI)