CAS 1346169-92-3 appears in our catalog under these names: MPT0B392, MPT0B392, 99.63%, MPT0B392 (Standard), MPT0B392, 99.0%. Offered by: AmBeed, MedChemExpress, Chemat. Available pack sizes: 100mg, 100 mg, 5 mg, 25 mg, 50 mg, 10 mg, 10mM/1mL, Get quote.
6-methoxy-2-(3,4,5-trimethoxyphenyl)sulfonylquinolin-5-amine (CAS 1346169-92-3) is a chemical compound with the molecular formula C19H20N2O6S and a molecular weight of 404.4 g/mol. IUPAC name: 6-methoxy-2-(3,4,5-trimethoxyphenyl)sulfonylquinolin-5-amine. InChIKey: RBBRZMLZQCYQJM-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O6S |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | 6-methoxy-2-(3,4,5-trimethoxyphenyl)sulfonylquinolin-5-amine |
| InChIKey | RBBRZMLZQCYQJM-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)N=C(C=C2)S(=O)(=O)C3=CC(=C(C(=C3)OC)OC)OC)N |
Computed by PubChem (NCBI)