Products 134624-47-8

CAS 134624-47-8 appears in our catalog under these names: (R)-2-Cyclopropyl-2-hydroxyacetic acid 97%, (2R)-2-cyclopropyl-2-hydroxyacetic acid, 97%, 97%, (R)-2-CYCLOPROPYL-2-HYDROXYACETIC ACID, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg.

Structural formula: {0} (CAS {1})

(2R)-2-cyclopropyl-2-hydroxyacetic acid (CAS 134624-47-8) is a chemical compound with the molecular formula C5H8O3 and a molecular weight of 116.11 g/mol. IUPAC name: (2R)-2-cyclopropyl-2-hydroxyacetic acid. InChIKey: WGYFYSOUPAKFHY-SCSAIBSYSA-N.

Identity
Molecular formulaC5H8O3
Molecular weight116.11 g/mol
IUPAC name(2R)-2-cyclopropyl-2-hydroxyacetic acid
InChIKeyWGYFYSOUPAKFHY-SCSAIBSYSA-N
SMILESC1CC1[C@H](C(=O)O)O

Computed by PubChem (NCBI)