CAS 13463-41-7 appears in our catalog under these names: Zinc Pyrithione, 1-Hydroxypyridine-2-thione Zinc, >95% (HPLC), Pyrithione zinc, Zinc pyrithione/ 99.64% (existing batch purity), Zinc Pyrithione. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: on request, 10g, 1g, 5g, 100mg, 500mg, 10mM (in 1ml dmso), 50mg.
Zinc bis(1-oxidopyridin-1-ium-2-thiolate) (CAS 13463-41-7) is a chemical compound with the molecular formula C10H8N2O2S2Zn and a molecular weight of 317.7 g/mol. IUPAC name: zinc bis(1-oxidopyridin-1-ium-2-thiolate). InChIKey: OTPSWLRZXRHDNX-UHFFFAOYSA-L.
| Molecular formula | C10H8N2O2S2Zn |
|---|---|
| Molecular weight | 317.7 g/mol |
| IUPAC name | zinc bis(1-oxidopyridin-1-ium-2-thiolate) |
| InChIKey | OTPSWLRZXRHDNX-UHFFFAOYSA-L |
| SMILES | C1=CC=[N+](C(=C1)[S-])[O-].C1=CC=[N+](C(=C1)[S-])[O-].[Zn+2] |
Computed by PubChem (NCBI)