CAS 1346447-11-7 is the registry number for tert-Butyl bis((3-fluoropyridin-2-yl)methyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N,N-bis[(3-fluoro-2-pyridinyl)methyl]carbamate (CAS 1346447-11-7) is a chemical compound with the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. IUPAC name: tert-butyl N,N-bis[(3-fluoro-2-pyridinyl)methyl]carbamate. InChIKey: NCLCGLXSDYMZJL-UHFFFAOYSA-N.
| Molecular formula | C17H19F2N3O2 |
|---|---|
| Molecular weight | 335.35 g/mol |
| IUPAC name | tert-butyl N,N-bis[(3-fluoro-2-pyridinyl)methyl]carbamate |
| InChIKey | NCLCGLXSDYMZJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CC1=C(C=CC=N1)F)CC2=C(C=CC=N2)F |
Computed by PubChem (NCBI)