CAS 1346447-43-5 appears in our catalog under these names: tert-Butyl 1h-pyrrolo[2,3-b]pyridin-6-ylcarbamate, 95%, tert-Butyl 1H-pyrrolo(2,3-b)pyridin-6-ylcarbamate. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 500mg.
Tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-6-yl)carbamate (CAS 1346447-43-5) is a chemical compound with the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. IUPAC name: tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-6-yl)carbamate. InChIKey: WRNKMGRTVONKFM-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O2 |
|---|---|
| Molecular weight | 233.27 g/mol |
| IUPAC name | tert-butyl N-(1H-pyrrolo[2,3-b]pyridin-6-yl)carbamate |
| InChIKey | WRNKMGRTVONKFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC2=C(C=C1)C=CN2 |
Computed by PubChem (NCBI)