CAS 1346521-42-3 is the registry number for 1H,1H,2H,2H-Perfluoroheptylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-amine (CAS 1346521-42-3) is a chemical compound with the molecular formula C7H6F11N and a molecular weight of 313.11 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-amine. InChIKey: GJWIRTQEBLHUMP-UHFFFAOYSA-N.
| Molecular formula | C7H6F11N |
|---|---|
| Molecular weight | 313.11 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-amine |
| InChIKey | GJWIRTQEBLHUMP-UHFFFAOYSA-N |
| SMILES | C(CN)C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)