Products 1346555-46-1
CAS 1346555-46-1 is the registry number for 2-(4-Bromo-3-fluorophenyl)propan-2-ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-bromo-3-fluorophenyl)propan-2-ol (CAS 1346555-46-1) is a chemical compound with the molecular formula C9H10BrFO and a molecular weight of 233.08 g/mol. IUPAC name: 2-(4-bromo-3-fluorophenyl)propan-2-ol. InChIKey: ZBKKYLXFHRTDOH-UHFFFAOYSA-N.
| Molecular formula | C9H10BrFO |
|---|---|
| Molecular weight | 233.08 g/mol |
| IUPAC name | 2-(4-bromo-3-fluorophenyl)propan-2-ol |
| InChIKey | ZBKKYLXFHRTDOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)Br)F)O |
Computed by PubChem (NCBI)