Products 1346597-54-3

CAS 1346597-54-3 is the registry number for 2,2-Difluoro-3-(methylamino)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2,2-difluoro-3-(methylamino)propanoic acid;hydrochloride (CAS 1346597-54-3) is a chemical compound with the molecular formula C4H8ClF2NO2 and a molecular weight of 175.56 g/mol. IUPAC name: 2,2-difluoro-3-(methylamino)propanoic acid;hydrochloride. InChIKey: NLPGSAKVSPCHEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H8ClF2NO2
Molecular weight175.56 g/mol
IUPAC name2,2-difluoro-3-(methylamino)propanoic acid;hydrochloride
InChIKeyNLPGSAKVSPCHEQ-UHFFFAOYSA-N
SMILESCNCC(C(=O)O)(F)F.Cl

Computed by PubChem (NCBI)