Products 1346598-27-3
CAS 1346598-27-3 is the registry number for 2-Ethyl-5-methyl-3,3-diphenyl-1-pyrroline-d3 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
2-methyl-4,4-diphenyl-5-(2,2,2-trideuterioethyl)-2,3-dihydropyrrole;hydrochloride (CAS 1346598-27-3) is a chemical compound with the molecular formula C19H22ClN and a molecular weight of 302.9 g/mol. IUPAC name: 2-methyl-4,4-diphenyl-5-(2,2,2-trideuterioethyl)-2,3-dihydropyrrole;hydrochloride. InChIKey: RFWQAFWWZQGUQU-NIIDSAIPSA-N.
| Molecular formula | C19H22ClN |
|---|---|
| Molecular weight | 302.9 g/mol |
| IUPAC name | 2-methyl-4,4-diphenyl-5-(2,2,2-trideuterioethyl)-2,3-dihydropyrrole;hydrochloride |
| InChIKey | RFWQAFWWZQGUQU-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])CC1=NC(CC1(C2=CC=CC=C2)C3=CC=CC=C3)C.Cl |
Computed by PubChem (NCBI)