CAS 1346598-51-3 appears in our catalog under these names: 2-Cyano-acetic Acid Sodium Salt-13C2, Sodium 2-cyanoacetate-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
Sodium 2-cyanoacetate (CAS 1346598-51-3) is a chemical compound with the molecular formula C3H2NNaO2 and a molecular weight of 109.029 g/mol. IUPAC name: sodium 2-cyanoacetate. InChIKey: JAUCIKCNYHCSIR-CFARNWPNSA-M.
| Molecular formula | C3H2NNaO2 |
|---|---|
| Molecular weight | 109.029 g/mol |
| IUPAC name | sodium 2-cyanoacetate |
| InChIKey | JAUCIKCNYHCSIR-CFARNWPNSA-M |
| SMILES | [13CH2](C#N)[13C](=O)[O-].[Na+] |
Computed by PubChem (NCBI)