CAS 1346598-53-5 is the registry number for Glutaronitrile-d6. Offered by: TRC. Available pack sizes: 100mg, 10mg.
2,2,3,3,4,4-hexadeuteriopentanedinitrile (CAS 1346598-53-5) is a chemical compound with the molecular formula C5H6N2 and a molecular weight of 100.15 g/mol. IUPAC name: 2,2,3,3,4,4-hexadeuteriopentanedinitrile. InChIKey: ZTOMUSMDRMJOTH-NMFSSPJFSA-N.
| Molecular formula | C5H6N2 |
|---|---|
| Molecular weight | 100.15 g/mol |
| IUPAC name | 2,2,3,3,4,4-hexadeuteriopentanedinitrile |
| InChIKey | ZTOMUSMDRMJOTH-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(C#N)C([2H])([2H])C([2H])([2H])C#N |
Computed by PubChem (NCBI)