Products 1346598-66-0
CAS 1346598-66-0 appears in our catalog under these names: Hordenine-d6, >95% (HPLC), Hordenine–d6, Hordenine-d6, 98.03%, D6-Hordenine. Offered by: TRC, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 50mg, 5mg, 1mg, 10mg, 5 mg, 1 mg, 10 mg, 1x10mg.
4-[2-[bis(trideuteriomethyl)amino]ethyl]phenol (CAS 1346598-66-0) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 171.27 g/mol. IUPAC name: 4-[2-[bis(trideuteriomethyl)amino]ethyl]phenol. InChIKey: KUBCEEMXQZUPDQ-WFGJKAKNSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 171.27 g/mol |
| IUPAC name | 4-[2-[bis(trideuteriomethyl)amino]ethyl]phenol |
| InChIKey | KUBCEEMXQZUPDQ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC1=CC=C(C=C1)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)