Products 1346599-02-7
CAS 1346599-02-7 is the registry number for 3,4-Dimethylphenol-d6. Offered by: TRC. Available pack sizes: 100mg.
3,4-bis(trideuteriomethyl)phenol (CAS 1346599-02-7) is a chemical compound with the molecular formula C8H10O and a molecular weight of 128.20 g/mol. IUPAC name: 3,4-bis(trideuteriomethyl)phenol. InChIKey: YCOXTKKNXUZSKD-WFGJKAKNSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 128.20 g/mol |
| IUPAC name | 3,4-bis(trideuteriomethyl)phenol |
| InChIKey | YCOXTKKNXUZSKD-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=C(C=C1)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)